Difference between revisions of "FORMYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6383 RXN-6383] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/4.2.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA FORMYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA FORMYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J |
| + | * common name: | ||
| + | ** formyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 791.513 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00798 C00798] |
| − | * | + | * CHEBI: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57376 57376] |
| − | + | * METABOLIGHTS : MTBLC57376 | |
| − | {{#set: | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266602 45266602] | |
| − | {{#set: | + | * HMDB : HMDB03419 |
| − | {{#set: | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J}} |
| − | {{#set: | + | {{#set: common name=formyl-CoA}} |
| + | {{#set: molecular weight=791.513 }} | ||
| + | {{#set: produced by=RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite FORMYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J
- common name:
- formyl-CoA
- molecular weight:
- 791.513
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
