Difference between revisions of "CPD-17385"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TAU-PROTEIN-KINASE-RXN TAU-PROTEIN-KINASE-RXN] == * direction: ** REVERSIBLE * common name: ** glyc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* common name: | * common name: | ||
− | ** | + | ** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J |
+ | * molecular weight: | ||
+ | ** 1102.034 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** tetracosahexaenoyl-CoA | ||
+ | ** all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA | ||
+ | ** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-16134]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16132]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581194 71581194] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74086 74086] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | + | {{#set: common name=(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J}} |
− | + | {{#set: molecular weight=1102.034 }} | |
− | + | {{#set: common name=tetracosahexaenoyl-CoA|all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA|(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}} | |
− | + | {{#set: consumed by=RXN-16134}} | |
− | + | {{#set: produced by=RXN-16132}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:59, 21 March 2018
Contents
Metabolite CPD-17385
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
- inchi key:
- InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J
- molecular weight:
- 1102.034
- Synonym(s):
- tetracosahexaenoyl-CoA
- all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA
- (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.