Difference between revisions of "Tiso gene 10754"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_10754 == * right end position: ** 8149 * transcription direction: ** POSITIVE * left end position: ** 6623 * centisome position: ** 79.5746...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10754 == |
− | * | + | * right end position: |
− | ** | + | ** 8149 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6623 |
− | * | + | * centisome position: |
− | ** | + | ** 79.57468 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] |
− | + | ** Source: [[orthology-synechocystis]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN0-5408]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXNQT-4142]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4702]] | ||
+ | * [[PWY-2301]] | ||
+ | * [[PWY-882]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8149}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=6623}} | |
− | + | {{#set: centisome position=79.57468 }} | |
− | + | {{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN0-5408|RXNQT-4142}} | |
− | + | {{#set: pathway associated=PWY-4702|PWY-2301|PWY-882}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:59, 21 March 2018
Gene Tiso_gene_10754
- right end position:
- 8149
- transcription direction:
- POSITIVE
- left end position:
- 6623
- centisome position:
- 79.57468
- Synonym(s):
Reactions associated
- Reaction: MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Reaction: RXN0-5408
- Source: orthology-esiliculosus
- Reaction: RXNQT-4142
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation