Difference between revisions of "RXN-7745"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7745 RXN-7745] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7745 RXN-7745] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CPD-7066]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[NADH]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 (2R,3S)-3-methylmalate[c] '''+''' 1 NAD+[c] '''=>''' 1 CO2[c] '''+''' 1 2-oxobutanoate[c] '''+''' 1 NADH[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2920]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5101]], L-isoleucine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] | ||
| + | ** '''5''' reactions found over '''8''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-athaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32718 32718] |
| − | * | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00994 R00994] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-1.1.1}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_2920}} |
| − | {{#set: | + | {{#set: in pathway=PWY-5101}} |
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction source=orthology-athaliana|orthology-synechocystis}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Reaction RXN-7745
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-7066[c] + 1 NAD[c] => 1 CARBON-DIOXIDE[c] + 1 2-OXOBUTANOATE[c] + 1 NADH[c]
- With common name(s):
- 1 (2R,3S)-3-methylmalate[c] + 1 NAD+[c] => 1 CO2[c] + 1 2-oxobutanoate[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2920
- Source: orthology-athaliana
- Source: orthology-synechocystis
Pathways
- PWY-5101, L-isoleucine biosynthesis II: PWY-5101
- 5 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-athaliana
External links
