Difference between revisions of "ATDAM"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDAM ATDAM] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dAMP phosphotransferase * Synon...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDAM ATDAM] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
+
 
* common name:
 
* common name:
−
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** ATP:dAMP phosphotransferase
−
* molecular weight:
+
−
** 744.043   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phosphatidylethanolamine (1-18:1-2-18:1)
 
−
** 18:1-18:1-PE
 
−
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15067]]
+
* With identifiers:
−
* [[PE1819Z1819Zt]]
+
** 1.0 [[DAMP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[DADP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[PE1819Z1819Zt]]
+
** 1.0 dAMP[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 dADP[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN-15036]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_805]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_5837]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_5839]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
+
{{#set: common name=ATP:dAMP phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_805|Tiso_gene_5837|Tiso_gene_5839}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=744.043    }}
+
−
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
−
{{#set: consumed by=RXN-15067|PE1819Z1819Zt}}
+
−
{{#set: produced by=PE1819Z1819Zt}}
+
−
{{#set: consumed or produced by=RXN-15036}}
+

Latest revision as of 20:00, 21 March 2018

Reaction ATDAM

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:dAMP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 dAMP[c] + 1.0 ATP[c] => 1.0 ADP[c] + 1.0 dADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATDAM&oldid=45151"