Difference between revisions of "CPD-13172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * common name: ** 6-hydroxy-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17881 RXN-17881] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
 +
* common name:
 +
** 6-hydroxy-2-cyclohexen-one-carboxylate
 +
* inchi key:
 +
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 155.13   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
 +
** HCC
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[N-terminal-L-cysteine]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[N-terminal-L-alanine-sulfenate]][c]
+
* [[RXN-12252]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 an N-terminal L-cysteinyl-[protein][c] '''+''' 1 hydrogen peroxide[c] '''=>''' 1 H2O[c] '''+''' 1 an N-terminal 3-sulfeno-L-alanyl-[protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
+
−
** '''8''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-7799}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=155.13    }}
 +
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
 +
{{#set: produced by=RXN-12252}}

Latest revision as of 21:00, 21 March 2018

Metabolite CPD-13172

  • smiles:
    • C(=O)(C1(O)(C=CCCC(=O)1))[O-]
  • common name:
    • 6-hydroxy-2-cyclohexen-one-carboxylate
  • inchi key:
    • InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
  • molecular weight:
    • 155.13
  • Synonym(s):
    • 6-hydroxy-2-cyclohexen-one-carboxylic acid
    • HCC

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13172&oldid=45175"