Difference between revisions of "CPD-13172"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-ubiquitinyl-proteins N-terminal-ubiquitinyl-proteins] == * common name: ** an N-term...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * common name: ** 6-hydroxy-...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == |
+ | * smiles: | ||
+ | ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
+ | * inchi key: | ||
+ | ** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 155.13 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-hydroxy-2-cyclohexen-one-carboxylic acid | ||
+ | ** HCC | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12252]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166] |
+ | {{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}} | ||
+ | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}} | ||
+ | {{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=155.13 }} | ||
+ | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}} | ||
+ | {{#set: produced by=RXN-12252}} |
Latest revision as of 21:00, 21 March 2018
Contents
Metabolite CPD-13172
- smiles:
- C(=O)(C1(O)(C=CCCC(=O)1))[O-]
- common name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- inchi key:
- InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
- molecular weight:
- 155.13
- Synonym(s):
- 6-hydroxy-2-cyclohexen-one-carboxylic acid
- HCC
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.