Difference between revisions of "CPD-14602"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine-38-40 tRNA-pseudouridine-38-40] == * common name: ** a pseudouridine38-40 in...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine-38-40 tRNA-pseudouridine-38-40] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
 +
* smiles:
 +
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
 
* common name:
 
* common name:
** a pseudouridine38-40 in tRNA
+
** mycophenolic acid O-acyl-glucuronide
 +
* inchi key:
 +
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
 +
* molecular weight:
 +
** 495.459   
 
* Synonym(s):
 
* Synonym(s):
** a tRNA pseudouridine38-40
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
* [[RXN-13607]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a pseudouridine38-40 in tRNA}}
+
* PUBCHEM:
{{#set: common name=a tRNA pseudouridine38-40}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
{{#set: produced by=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
 +
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
 +
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
 +
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
 +
{{#set: molecular weight=495.459    }}
 +
{{#set: produced by=RXN-13607}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-14602

  • smiles:
    • CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
  • common name:
    • mycophenolic acid O-acyl-glucuronide
  • inchi key:
    • InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
  • molecular weight:
    • 495.459
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)" cannot be used as a page name in this wiki.