|
|
| (One intermediate revision by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Reaction]] | + | [[Category:Metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.4.11-RXN 3.1.4.11-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
| − | * direction: | + | * smiles: |
| − | ** LEFT-TO-RIGHT | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
| | * common name: | | * common name: |
| − | ** phospholipase_c_beta_4 | + | ** keto-D-fructose |
| − | ** 1-phosphatidylinositol-_-bisphosphate_phosphodiesterase_gamma-2 | + | * inchi key: |
| − | * ec number: | + | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| − | ** [http://enzyme.expasy.org/EC/3.1.4.11 EC-3.1.4.11] | + | * molecular weight: |
| | + | ** 180.157 |
| | * Synonym(s): | | * Synonym(s): |
| | | | |
| − | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
| − | * With identifiers:
| + | * [[RXN-14515]] |
| − | ** 1 [[WATER]][c] '''+''' 1 [[PHOSPHATIDYL-MYO-INOSITOL-45-BISPHOSPHA]][c] '''=>''' 1 [[INOSITOL-1-4-5-TRISPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DIACYLGLYCEROL]][c]
| + | == Reaction(s) known to produce the compound == |
| − | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
| − | ** 1 H2O[c] '''+''' 1 a 1-phosphatidyl-1D-myo-inositol 4,5-bisphosphate[c] '''=>''' 1 D-myo-inositol (1,4,5)-trisphosphate[c] '''+''' 1 H+[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c]
| + | * [[RXN-7644]] |
| − | | + | |
| − | == Genes associated with this reaction == | + | |
| − | Genes have been associated with this reaction based on different elements listed below.
| + | |
| − | * [[Tiso_gene_12019]] | + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_12020]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | ** [[pantograph]]-[[esiliculosus]]
| + | |
| − | * [[Tiso_gene_7561]]
| + | |
| − | ** IN-SILICO_ANNOTATION
| + | |
| − | ***EC-NUMBER
| + | |
| − | == Pathways == | + | |
| − | * [[PWY-6367]], D-myo-inositol-5-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6367 PWY-6367]
| + | |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| + | |
| − | * [[PWY-6351]], D-myo-inositol (1,4,5)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6351 PWY-6351]
| + | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | * [[PWY-7039]], phosphatidate metabolism, as a signaling molecule: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7039 PWY-7039]
| + | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | * [[LIPASYN-PWY]], phospholipases: [http://metacyc.org/META/NEW-IMAGE?object=LIPASYN-PWY LIPASYN-PWY]
| + | |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
| − | == Reconstruction information == | + | |
| − | * Category: [[orthology]] | + | |
| − | ** Source: [[orthology-esiliculosus]]
| + | |
| − | *** Tool: [[pantograph]]
| + | |
| − | * Category: [[annotation]]
| + | |
| − | ** Source: [[annotation-in-silico_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| − | ** Source: [[annotation-experimental_annotation]]
| + | |
| − | *** Tool: [[pathwaytools]]
| + | |
| | == External links == | | == External links == |
| − | * LIGAND-RXN: | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03435 R03435] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] |
| − | * UNIPROT:
| + | * CHEBI: |
| − | ** [http://www.uniprot.org/uniprot/P10687 P10687]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] |
| − | ** [http://www.uniprot.org/uniprot/P10894 P10894]
| + | * METABOLIGHTS : MTBLC48095 |
| − | ** [http://www.uniprot.org/uniprot/P10686 P10686] | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} |
| − | ** [http://www.uniprot.org/uniprot/P24135 P24135] | + | {{#set: common name=keto-D-fructose}} |
| − | ** [http://www.uniprot.org/uniprot/P19174 P19174]
| + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} |
| − | ** [http://www.uniprot.org/uniprot/Q00722 Q00722]
| + | {{#set: molecular weight=180.157 }} |
| − | ** [http://www.uniprot.org/uniprot/Q02158 Q02158] | + | {{#set: consumed by=RXN-14515}} |
| − | ** [http://www.uniprot.org/uniprot/P32383 P32383]
| + | {{#set: reversible reaction associated=RXN-7644}} |
| − | ** [http://www.uniprot.org/uniprot/Q9TS13 Q9TS13]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q24284 Q24284]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P51178 P51178]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P10688 P10688]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P10895 P10895]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q60450 Q60450]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P08487 P08487]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q9STZ3 Q9STZ3]
| + | |
| − | ** [http://www.uniprot.org/uniprot/P40977 P40977]
| + | |
| − | ** [http://www.uniprot.org/uniprot/Q21754 Q21754]
| + | |
| − | {{#set: direction=LEFT-TO-RIGHT}} | + | |
| − | {{#set: common name=phospholipase_c_beta_4}}
| + | |
| − | {{#set: common name=1-phosphatidylinositol-_-bisphosphate_phosphodiesterase_gamma-2}} | + | |
| − | {{#set: ec number=EC-3.1.4.11}} | + | |
| − | {{#set: gene associated=Tiso_gene_12019|Tiso_gene_12020|Tiso_gene_7561}}
| + | |
| − | {{#set: in pathway=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}}
| + | |
| − | {{#set: reconstruction category=orthology|annotation}} | + | |
| − | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | + | |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |
