Difference between revisions of "CPD-7088"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * co...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == |
* smiles: | * smiles: | ||
− | ** | + | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (2R,3S,4S)-leucodelphinidin |
+ | * inchi key: | ||
+ | ** InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 322.271 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (2R,3S,4S)-leucoefdin |
− | + | ** (2R,3S,4S)-leucodelfinidin | |
− | + | ||
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7785]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7784]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=59024521 59024521] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles= | + | ** [http://www.chemspider.com/Chemical-Structure.2338991.html 2338991] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417] |
− | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC71216 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909] |
− | {{#set: produced by= | + | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}} |
+ | {{#set: common name=(2R,3S,4S)-leucodelphinidin}} | ||
+ | {{#set: inchi key=InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N}} | ||
+ | {{#set: molecular weight=322.271 }} | ||
+ | {{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}} | ||
+ | {{#set: consumed by=RXN-7785}} | ||
+ | {{#set: produced by=RXN-7784}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-7088
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)
- common name:
- (2R,3S,4S)-leucodelphinidin
- inchi key:
- InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N
- molecular weight:
- 322.271
- Synonym(s):
- (2R,3S,4S)-leucoefdin
- (2R,3S,4S)-leucodelfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links