Difference between revisions of "CPD-7088"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9874 == * left end position: ** 3470 * transcription direction: ** POSITIVE * right end position: ** 5787 * centisome position: ** 38.54699...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) * co...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7088 CPD-7088] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O) |
| − | * | + | * common name: |
| − | ** | + | ** (2R,3S,4S)-leucodelphinidin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 322.271 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (2R,3S,4S)-leucoefdin | ||
| + | ** (2R,3S,4S)-leucodelfinidin | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-7785]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7784]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=59024521 59024521] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.2338991.html 2338991] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6417 6417] |
| + | * METABOLIGHTS : MTBLC71216 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05909 C05909] | ||
| + | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)}} | ||
| + | {{#set: common name=(2R,3S,4S)-leucodelphinidin}} | ||
| + | {{#set: inchi key=InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N}} | ||
| + | {{#set: molecular weight=322.271 }} | ||
| + | {{#set: common name=(2R,3S,4S)-leucoefdin|(2R,3S,4S)-leucodelfinidin}} | ||
| + | {{#set: consumed by=RXN-7785}} | ||
| + | {{#set: produced by=RXN-7784}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-7088
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC(O)=C(C(O)=3)O)
- common name:
- (2R,3S,4S)-leucodelphinidin
- inchi key:
- InChIKey=ZEACOKJOQLAYTD-SOUVJXGZSA-N
- molecular weight:
- 322.271
- Synonym(s):
- (2R,3S,4S)-leucoefdin
- (2R,3S,4S)-leucodelfinidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
