Difference between revisions of "CPD-15373"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2100 == * Synonym(s): == Reactions associated == * 3.1.3.46-RXN ** experimental_annotation ***automated-name-match ** pantograph-[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ma...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_2100 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15373 CPD-15373] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(O)C(O)CO
 +
* common name:
 +
** aldehydo-D-mannose
 +
* inchi key:
 +
** InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
 +
* molecular weight:
 +
** 180.157   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.3.46-RXN]]
+
* [[RXN-14501]]
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[athaliana]]
+
* [[1.1.1.255-RXN]]
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
+
* [[RXN-14500]]
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
== Pathways associated ==
+
* [[PWY66-423]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=3.1.3.46-RXN|6-PHOSPHOFRUCTO-2-KINASE-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY66-423}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161658 161658]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37675 37675]
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)CO}}
 +
{{#set: common name=aldehydo-D-mannose}}
 +
{{#set: inchi key=InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N}}
 +
{{#set: molecular weight=180.157    }}
 +
{{#set: consumed by=RXN-14501}}
 +
{{#set: reversible reaction associated=1.1.1.255-RXN|RXN-14500}}

Latest revision as of 20:01, 21 March 2018

Metabolite CPD-15373

  • smiles:
    • [CH](=O)C(O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-D-mannose
  • inchi key:
    • InChIKey=GZCGUPFRVQAUEE-KVTDHHQDSA-N
  • molecular weight:
    • 180.157
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.