Difference between revisions of "D-SERINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pyruvate-dehydrogenases Pyruvate-dehydrogenases] == * common name: ** a pyruvate dehydrogenase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] == * smiles: ** C(O)C([N+])C([O-])=O * common name: ** D-serine * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] == |
+ | * smiles: | ||
+ | ** C(O)C([N+])C([O-])=O | ||
* common name: | * common name: | ||
− | ** | + | ** D-serine |
+ | * inchi key: | ||
+ | ** InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N | ||
+ | * molecular weight: | ||
+ | ** 105.093 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[5.1.1.18-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 312-84-5 |
− | {{#set: common name= | + | * BIGG : ser__D |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857549 6857549] | ||
+ | * HMDB : HMDB03406 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00740 C00740] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35247 35247] | ||
+ | * METABOLIGHTS : MTBLC35247 | ||
+ | {{#set: smiles=C(O)C([N+])C([O-])=O}} | ||
+ | {{#set: common name=D-serine}} | ||
+ | {{#set: inchi key=InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N}} | ||
+ | {{#set: molecular weight=105.093 }} | ||
+ | {{#set: produced by=5.1.1.18-RXN}} |
Latest revision as of 21:01, 21 March 2018
Contents
Metabolite D-SERINE
- smiles:
- C(O)C([N+])C([O-])=O
- common name:
- D-serine
- inchi key:
- InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
- molecular weight:
- 105.093
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 312-84-5
- BIGG : ser__D
- PUBCHEM:
- HMDB : HMDB03406
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC35247
"C(O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.