Difference between revisions of "GDP-MANNOSE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13871 RXN-13871] == * direction: ** REVERSIBLE * common name: ** arylamine_n-acetyltransferase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == * smiles: ** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-MANNOSE GDP-MANNOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34))) |
* common name: | * common name: | ||
− | ** | + | ** GDP-α-D-mannose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L |
+ | * molecular weight: | ||
+ | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** guanosine pyrophosphate mannose | ||
+ | ** guanosine diphosphomannose | ||
+ | ** guanosine diphosphate mannose | ||
+ | ** GDP-mannose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-5464]] |
− | + | * [[GDPMANDEHYDRA-RXN]] | |
− | * | + | * [[RXN-5462]] |
− | + | * [[RXN-5463]] | |
− | + | * [[2.4.1.83-RXN]] | |
− | == | + | * [[2.4.1.142-RXN]] |
− | + | * [[RXN-16602]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.7.7.13-RXN]] | |
− | + | * [[GAMPG]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.4.1.232-RXN]] | |
− | == | + | * [[2.4.1.32-RXN]] |
− | + | * [[RXN-1882]] | |
− | * [[ | + | * [[RXN-7771]] |
− | + | * [[MANNPGUANYLTRANGDP-RXN]] | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 18441-12-8 |
− | {{#set: common name= | + | * CAS : 3123-67-9 |
− | {{#set: | + | * BIGG : gdpmann |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878389 46878389] |
− | {{#set: | + | * HMDB : HMDB01163 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00096 C00096] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57527 57527] | ||
+ | * METABOLIGHTS : MTBLC57527 | ||
+ | {{#set: smiles=C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))}} | ||
+ | {{#set: common name=GDP-α-D-mannose}} | ||
+ | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L}} | ||
+ | {{#set: molecular weight=603.329 }} | ||
+ | {{#set: common name=guanosine pyrophosphate mannose|guanosine diphosphomannose|guanosine diphosphate mannose|GDP-mannose}} | ||
+ | {{#set: consumed by=RXN-5464|GDPMANDEHYDRA-RXN|RXN-5462|RXN-5463|2.4.1.83-RXN|2.4.1.142-RXN|RXN-16602}} | ||
+ | {{#set: produced by=2.7.7.13-RXN|GAMPG}} | ||
+ | {{#set: reversible reaction associated=2.4.1.232-RXN|2.4.1.32-RXN|RXN-1882|RXN-7771|MANNPGUANYLTRANGDP-RXN}} |
Latest revision as of 21:01, 21 March 2018
Contents
Metabolite GDP-MANNOSE
- smiles:
- C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))
- common name:
- GDP-α-D-mannose
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-GDJBGNAASA-L
- molecular weight:
- 603.329
- Synonym(s):
- guanosine pyrophosphate mannose
- guanosine diphosphomannose
- guanosine diphosphate mannose
- GDP-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 18441-12-8
- CAS : 3123-67-9
- BIGG : gdpmann
- PUBCHEM:
- HMDB : HMDB01163
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57527
"C(OP([O-])(=O)OP([O-])(=O)OC1(OC(C(O)C(O)C(O)1)CO))C2(C(O)C(O)C(O2)N4(C=NC3(C(=O)NC(N)=NC=34)))" cannot be used as a page name in this wiki.