Difference between revisions of "Mercapturates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] == * smiles: ** C(O)C([N+])C([O-])=O * common name: ** D-serine * inchi key:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mercapturates Mercapturates] == * common name: ** a mercapturate * Synonym(s): ** an S-substitu...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-SERINE D-SERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mercapturates Mercapturates] ==
* smiles:
+
** C(O)C([N+])C([O-])=O
+
 
* common name:
 
* common name:
** D-serine
+
** a mercapturate
* inchi key:
+
** InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
+
* molecular weight:
+
** 105.093   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an S-substituted-N-acetyl-L-cysteine
 +
** an N-acetyl-L-cysteine-S-conjugate
 +
** a mercapturic acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[5.1.1.18-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13684]]
 
== External links  ==
 
== External links  ==
* CAS : 312-84-5
+
{{#set: common name=a mercapturate}}
* BIGG : ser__D
+
{{#set: common name=an S-substituted-N-acetyl-L-cysteine|an N-acetyl-L-cysteine-S-conjugate|a mercapturic acid}}
* PUBCHEM:
+
{{#set: reversible reaction associated=RXN-13684}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857549 6857549]
+
* HMDB : HMDB03406
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00740 C00740]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35247 35247]
+
* METABOLIGHTS : MTBLC35247
+
{{#set: smiles=C(O)C([N+])C([O-])=O}}
+
{{#set: common name=D-serine}}
+
{{#set: inchi key=InChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N}}
+
{{#set: molecular weight=105.093    }}
+
{{#set: produced by=5.1.1.18-RXN}}
+

Latest revision as of 20:02, 21 March 2018

Metabolite Mercapturates

  • common name:
    • a mercapturate
  • Synonym(s):
    • an S-substituted-N-acetyl-L-cysteine
    • an N-acetyl-L-cysteine-S-conjugate
    • a mercapturic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links