Difference between revisions of "RXN-7677"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * inchi key: ** InC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7677 RXN-7677] == * direction: ** LEFT-TO-RIGHT * common name: ** 71-hydroxychlorophyllide a mo...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7677 RXN-7677] ==
−
* smiles:
+
* direction:
−
** COC1(C=C(C=CC=O)C=C(OC)C(O)=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N
+
 
* common name:
 
* common name:
−
** sinapaldehyde
+
** 71-hydroxychlorophyllide a monooxygenase
−
* molecular weight:
+
** rieske_2fe-2sdomainiss
−
** 208.213   
+
** tic55_component_of_chloroplast_import_machinery
 +
** isp_domain-containing_protein
 
* Synonym(s):
 
* Synonym(s):
 +
** chlorophyllide a oxygenase
 +
** chlorophyll-b synthase
 +
** CAO
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-1125]]
+
* With identifiers:
−
* [[RXN-8014]]
+
** 1 [[CPD-7015]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-7014]][c] '''+''' 2 [[WATER]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-1143]]
+
** 1 71-hydroxychlorophyllide a[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 chlorophyllide b[c] '''+''' 2 H2O[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN-1124]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13817]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_8091]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_4002]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12611]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_152]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5068]], chlorophyll cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5068 PWY-5068]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280802 5280802]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08204 R08204]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.4444359.html 4444359]
+
{{#set: common name=71-hydroxychlorophyllide a monooxygenase}}
−
* CHEBI:
+
{{#set: common name=rieske_2fe-2sdomainiss}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27949 27949]
+
{{#set: common name=tic55_component_of_chloroplast_import_machinery}}
−
* METABOLIGHTS : MTBLC27949
+
{{#set: common name=isp_domain-containing_protein}}
−
* LIGAND-CPD:
+
{{#set: common name=chlorophyllide a oxygenase|chlorophyll-b synthase|CAO}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05610 C05610]
+
{{#set: gene associated=Tiso_gene_13817|Tiso_gene_8091|Tiso_gene_4002|Tiso_gene_12611|Tiso_gene_152}}
−
{{#set: smiles=COC1(C=C(C=CC=O)C=C(OC)C(O)=1)}}
+
{{#set: in pathway=PWY-5068}}
−
{{#set: inchi key=InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=sinapaldehyde}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: molecular weight=208.213    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN-1125|RXN-8014}}
+
−
{{#set: produced by=RXN-1143}}
+
−
{{#set: consumed or produced by=RXN-1124}}
+

Latest revision as of 20:02, 21 March 2018

Reaction RXN-7677

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 71-hydroxychlorophyllide a monooxygenase
    • rieske_2fe-2sdomainiss
    • tic55_component_of_chloroplast_import_machinery
    • isp_domain-containing_protein
  • Synonym(s):
    • chlorophyllide a oxygenase
    • chlorophyll-b synthase
    • CAO

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 71-hydroxychlorophyllide a[c] + 1 oxygen[c] + 1 NADPH[c] + 1 H+[c] => 1 NADP+[c] + 1 chlorophyllide b[c] + 2 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5068, chlorophyll cycle: PWY-5068
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7677&oldid=45365"