Difference between revisions of "CPD-315"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5838 == * right end position: ** 3410 * transcription direction: ** POSITIVE * left end position: ** 1939 * centisome position: ** 15.06136...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == * smiles: ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-315 CPD-315] == |
− | * | + | * smiles: |
− | ** | + | ** CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12)))) |
− | * | + | * common name: |
− | ** | + | ** cyanocob(III)alamin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 1355.377 |
* Synonym(s): | * Synonym(s): | ||
+ | ** cyanocobalamin | ||
+ | ** rubramin | ||
+ | ** vitamin B12 | ||
+ | ** alphamine | ||
+ | ** crystamine | ||
+ | ** cyanoject | ||
+ | ** cyomin | ||
+ | ** cytamen | ||
+ | ** hydrobexan | ||
+ | ** rubesol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[TransportSeed_CPD-315]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[TransportSeed_CPD-315]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ExchangeSeed_CPD-315]] | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 68-19-9 |
− | {{#set: | + | * DRUGBANK : DB00115 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678590 70678590] |
− | {{#set: | + | * HMDB : HMDB00607 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02823 C02823] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17439 17439] | ||
+ | {{#set: smiles=CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))}} | ||
+ | {{#set: common name=cyanocob(III)alamin}} | ||
+ | {{#set: inchi key=InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L}} | ||
+ | {{#set: molecular weight=1355.377 }} | ||
+ | {{#set: common name=cyanocobalamin|rubramin|vitamin B12|alphamine|crystamine|cyanoject|cyomin|cytamen|hydrobexan|rubesol}} | ||
+ | {{#set: consumed by=TransportSeed_CPD-315}} | ||
+ | {{#set: produced by=TransportSeed_CPD-315}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_CPD-315}} |
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite CPD-315
- smiles:
- CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))
- common name:
- cyanocob(III)alamin
- inchi key:
- InChIKey=RMRCNWBMXRMIRW-WZHZPDAFSA-L
- molecular weight:
- 1355.377
- Synonym(s):
- cyanocobalamin
- rubramin
- vitamin B12
- alphamine
- crystamine
- cyanoject
- cyomin
- cytamen
- hydrobexan
- rubesol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC4(=C(C)C=C3(N2(C%12(OC(CO)C(OP(=O)(O[CH](C)CNC(=O)CCC1(C)(C(CC(=O)N)[CH]%11(C8(C)(C(CC(=O)N)(C)C(CCC(=O)N)C7(C(C)=C%10(C(CC(=O)N)(C)C(CCC(=O)N)C9(C=C6(C(C)(C)C(CCC(=O)N)C5(C(C)=C1N([Co---]([N+](=C2)C3=C4)(C#N)([N+]=56)([N+]=78)[N+]=9%10)%11)))))))))[O-])C(O)%12))))" cannot be used as a page name in this wiki.