Difference between revisions of "RXN-161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-161 RXN-161] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1.1 E...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-161 RXN-161] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[BUTANOL]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[BUTANAL]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] |
− | * [[ | + | * With common name(s): |
− | = | + | ** 1 butan-1-ol[c] '''+''' 1 NAD+[c] '''<=>''' 1 butan-1-al[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-6583]], pyruvate fermentation to butanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6583 PWY-6583] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7396]], butanol and isobutanol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-6883]], pyruvate fermentation to butanol II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6883 PWY-6883] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33199 33199] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03544 R03544] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | {{#set: | + | {{#set: ec number=EC-1.1.1}} |
− | {{#set: | + | {{#set: in pathway=PWY-6583|PWY-7396|PWY-6883}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + |
Latest revision as of 20:02, 21 March 2018
Contents
Reaction RXN-161
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 butan-1-ol[c] + 1 NAD+[c] <=> 1 butan-1-al[c] + 1 H+[c] + 1 NADH[c]
Genes associated with this reaction
Pathways
- PWY-6583, pyruvate fermentation to butanol I: PWY-6583
- 4 reactions found over 8 reactions in the full pathway
- PWY-7396, butanol and isobutanol biosynthesis (engineered): PWY-7396
- 4 reactions found over 8 reactions in the full pathway
- PWY-6883, pyruvate fermentation to butanol II (engineered): PWY-6883
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links