Difference between revisions of "Tiso gene 18145"

Latest revision as of 20:02, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
+== Gene Tiso_gene_18145 ==
-* smiles:
-** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
-* inchi key:
-** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
-* common name:
-** &beta;-D-fructofuranose 1-phosphate
-* molecular weight:
-** 258.121
 * Synonym(s):
-** &beta;-D-fructofuranose-1-P
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-8631]]
+* Reaction: [[1.14.11.2-RXN]]
-== Reaction(s) known to produce the compound ==
+** Source: [[orthology-esiliculosus]]
-* [[KETOHEXOKINASE-RXN]]
+* Reaction: [[RXN490-3641]]
-== Reaction(s) of unknown directionality ==
+** Source: [[orthology-esiliculosus]]
+== Pathways associated ==
 == External links  ==
-* CAS : 15978-08-2
+{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
-* PUBCHEM:
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
-* BIGG : f1p
-{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
-{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
-{{#set: common name=&beta;-D-fructofuranose 1-phosphate}}
-{{#set: molecular weight=258.121    }}
-{{#set: common name=&beta;-D-fructofuranose-1-P}}
-{{#set: consumed by=RXN-8631}}
-{{#set: produced by=KETOHEXOKINASE-RXN}}