Difference between revisions of "Very-Long-Chain-oxoacyl-CoAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-Long-Chain-oxoacyl-CoAs Very-Long-Chain-oxoacyl-CoAs] == * common name: ** a very-long-cha...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15666 CPD-15666] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-Long-Chain-oxoacyl-CoAs Very-Long-Chain-oxoacyl-CoAs] ==
* smiles:
+
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J
+
 
* common name:
 
* common name:
** 6-cis, 2-trans-tridecadienoyl-CoA
+
** a very-long-chain oxoacyl-CoA
* molecular weight:
+
** 955.803   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z, 2E-tridecadienoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7698]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14771]]
+
* [[RXN-7697]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a very-long-chain oxoacyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658546 90658546]
+
{{#set: consumed by=RXN-7698}}
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: produced by=RXN-7697}}
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-GTUBXKNVSA-J}}
+
{{#set: common name=6-cis, 2-trans-tridecadienoyl-CoA}}
+
{{#set: molecular weight=955.803    }}
+
{{#set: common name=6Z, 2E-tridecadienoyl-CoA}}
+
{{#set: produced by=RXN-14771}}
+

Latest revision as of 20:02, 21 March 2018

Metabolite Very-Long-Chain-oxoacyl-CoAs

  • common name:
    • a very-long-chain oxoacyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links