Difference between revisions of "Lipoyl-Protein-L-Lysine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipoyl-Protein-L-Lysine Lipoyl-Protein-L-Lysine] == * common name: ** a [lipoyl-carrier protein...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipoyl-Protein-L-Lysine Lipoyl-Protein-L-Lysine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [lipoyl-carrier protein]-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-947]] |
| − | * [[ | + | * [[RXN-17127]] |
| − | * [[ | + | * [[RXN0-5098]] |
| + | * [[RXN-8655]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [lipoyl-carrier protein]-L-lysine}} | |
| − | + | {{#set: consumed by=RXN0-947|RXN-17127|RXN0-5098|RXN-8655}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed by= | + | |
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite Lipoyl-Protein-L-Lysine
- common name:
- a [lipoyl-carrier protein]-L-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [lipoyl-carrier protein]-L-lysine" cannot be used as a page name in this wiki.
