Difference between revisions of "CPD-13576"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12200 RXN-12200] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * common name:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) |
* common name: | * common name: | ||
| − | ** | + | ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K |
| + | * molecular weight: | ||
| + | ** 264.169 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cThz-P | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-12610]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890] |
| − | {{#set: | + | {{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}} |
| − | {{#set: | + | {{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}} |
| − | {{#set: | + | {{#set: molecular weight=264.169 }} |
| + | {{#set: common name=cThz-P}} | ||
| + | {{#set: consumed by=RXN-12610}} | ||
Latest revision as of 21:02, 21 March 2018
Contents
Metabolite CPD-13576
- smiles:
- CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
- common name:
- 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
- inchi key:
- InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
- molecular weight:
- 264.169
- Synonym(s):
- cThz-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.
