Difference between revisions of "RXN-1104"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1104 RXN-1104] == * direction: ** LEFT-TO-RIGHT * common name: ** caffeate_o-methyltransferase...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1104 RXN-1104] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** caffeate_o-methyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.1.68 EC-2.1.1.68] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-676]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[FERULIC-ACID]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 S-adenosyl-L-methionine[c] '''+''' 1 trans-caffeate[c] '''=>''' 1 H+[c] '''+''' 1 ferulate[c] '''+''' 1 S-adenosyl-L-homocysteine[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18971]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_18257]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2181]], free phenylpropanoid acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2181 PWY-2181] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-7498]], phenylpropanoids methylation (ice plant): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7498 PWY-7498] | ||
+ | ** '''2''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-1121]], suberin monomers biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-1121 PWY-1121] | ||
+ | ** '''9''' reactions found over '''19''' reactions in the full pathway | ||
+ | * [[PWY-7186]], superpathway of scopolin and esculin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7186 PWY-7186] | ||
+ | ** '''2''' reactions found over '''14''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20225 20225] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03366 R03366] |
− | * | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/Q41086 Q41086] | |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P28002 P28002] |
− | + | ** [http://www.uniprot.org/uniprot/Q00763 Q00763] | |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | + | {{#set: common name=caffeate_o-methyltransferase}} | |
− | ** [http://www. | + | {{#set: ec number=EC-2.1.1.68}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_18971|Tiso_gene_18257}} |
− | {{#set: | + | {{#set: in pathway=PWY-2181|PWY-7498|PWY-1121|PWY-7186}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + |
Latest revision as of 21:02, 21 March 2018
Contents
Reaction RXN-1104
- direction:
- LEFT-TO-RIGHT
- common name:
- caffeate_o-methyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 S-ADENOSYLMETHIONINE[c] + 1 CPD-676[c] => 1 PROTON[c] + 1 FERULIC-ACID[c] + 1 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 S-adenosyl-L-methionine[c] + 1 trans-caffeate[c] => 1 H+[c] + 1 ferulate[c] + 1 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18971
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18257
- Source: orthology-esiliculosus
Pathways
- PWY-2181, free phenylpropanoid acid biosynthesis: PWY-2181
- 3 reactions found over 4 reactions in the full pathway
- PWY-7498, phenylpropanoids methylation (ice plant): PWY-7498
- 2 reactions found over 10 reactions in the full pathway
- PWY-1121, suberin monomers biosynthesis: PWY-1121
- 9 reactions found over 19 reactions in the full pathway
- PWY-7186, superpathway of scopolin and esculin biosynthesis: PWY-7186
- 2 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links