Difference between revisions of "CPD-17637"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * common name: ** 7-hydroxylaurate...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-146 RXN66-146] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCC(O)CCCCCC([O-])=O
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
+
** 7-hydroxylaurate
 +
* inchi key:
 +
** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 215.312   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-hydroxydodecanoic acid
 +
** 7-hydroxylauric acid
 +
** 7-hydroxydodecanoate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-12184]]
** 1 [[NICOTINE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-3187]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 (S)-nicotine[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''=>''' 1 2'-hydroxynicotine[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_1035]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY66-201]], nicotine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-201 PWY66-201]
+
** '''3''' reactions found over '''17''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-1.14.14.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904]
{{#set: gene associated=Tiso_gene_1035}}
+
* CHEBI:
{{#set: in pathway=PWY66-201}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921]
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=7-hydroxylaurate}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=215.312    }}
 +
{{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}}
 +
{{#set: consumed by=RXN-12184}}

Latest revision as of 20:02, 21 March 2018

Metabolite CPD-17637

  • smiles:
    • CCCCCC(O)CCCCCC([O-])=O
  • common name:
    • 7-hydroxylaurate
  • inchi key:
    • InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
  • molecular weight:
    • 215.312
  • Synonym(s):
    • 7-hydroxydodecanoic acid
    • 7-hydroxylauric acid
    • 7-hydroxydodecanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)CCCCCC([O-])=O" cannot be used as a page name in this wiki.