Difference between revisions of "RXN1F-144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-144 RXN1F-144] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-144 RXN1F-144] ==
−
* smiles:
+
* direction:
−
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
+
** [http://enzyme.expasy.org/EC/2.5.1.99 EC-2.5.1.99]
−
* common name:
+
−
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
−
* molecular weight:
+
−
** 221.167   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 
−
** 4-methyl-5-(2-phosphoethyl)-thiazole
 
−
** THZ-P
 
−
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 
−
** HET-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[THI-P-SYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[GERANYLGERANYL-PP]][c] '''<=>''' 1 [[PHYTOENE]][c] '''+''' 2 [[PPI]][c]
−
* [[THIAZOLSYN3-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 2 geranylgeranyl diphosphate[c] '''<=>''' 1 all-trans-phytoene[c] '''+''' 2 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15914]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32454 32454]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07916 R07916]
−
* BIGG : 4mpetz
+
{{#set: direction=REVERSIBLE}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.5.1.99}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
+
{{#set: gene associated=Tiso_gene_15914}}
−
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: molecular weight=221.167    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(&beta;-hydroxyethyl)thiazole phosphate|HET-P}}
+
−
{{#set: consumed by=THI-P-SYN-RXN}}
+
−
{{#set: produced by=THIAZOLSYN3-RXN}}
+

Latest revision as of 21:02, 21 March 2018

Reaction RXN1F-144

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2 geranylgeranyl diphosphate[c] <=> 1 all-trans-phytoene[c] + 2 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1F-144&oldid=45470"