Difference between revisions of "Tiso gene 9986"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_9986 == * Synonym(s): == Reactions associated == * Reaction: UBIQUITIN-THIOLESTERASE-RXN ** Source: orthology-esiliculosus == Path...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9986 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[UBIQUITIN-THIOLESTERASE-RXN]] |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=UBIQUITIN-THIOLESTERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:02, 21 March 2018
Gene Tiso_gene_9986
- Synonym(s):
Reactions associated
- Reaction: UBIQUITIN-THIOLESTERASE-RXN
- Source: orthology-esiliculosus