Difference between revisions of "Tiso gene 17043"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] == * smiles: ** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_17043 == * right end position: ** 3383 * transcription direction: ** POSITIVE * left end position: ** 2279 * centisome position: ** 57.5505...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12897 CPD-12897] ==
+
== Gene Tiso_gene_17043 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3383
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 7-methyl-3-oxooct-6-enoyl-CoA
+
** 2279
−
* molecular weight:
+
* centisome position:
−
** 915.695    
+
** 57.550507    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-methyl-3-oxo-6-octenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11917]]
+
* Reaction: [[ACSERLY-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12726]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[SULFOCYS-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3383}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986200 50986200]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=2279}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71410 71410]
+
{{#set: centisome position=57.550507   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ACSERLY-RXN|RXN-12726|SULFOCYS-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16466 C16466]
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-6936}}
−
* HMDB : HMDB60421
+
−
{{#set: smiles=CC(C)=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LPMIXVANMSEERY-FUEUKBNZSA-J}}
+
−
{{#set: common name=7-methyl-3-oxooct-6-enoyl-CoA}}
+
−
{{#set: molecular weight=915.695   }}
+
−
{{#set: common name=7-methyl-3-oxo-6-octenoyl-CoA}}
+
−
{{#set: consumed by=RXN-11917}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_17043

  • right end position:
    • 3383
  • transcription direction:
    • POSITIVE
  • left end position:
    • 2279
  • centisome position:
    • 57.550507
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17043&oldid=45501"