Difference between revisions of "CPD-13040"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10847 RXN-10847] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == * smiles: ** CCCC(OCC(OC(CCC)=O)CO)=O * common name: ** 1,2-dibutyrin *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == |
− | * | + | * smiles: |
− | ** | + | ** CCCC(OCC(OC(CCC)=O)CO)=O |
* common name: | * common name: | ||
− | ** | + | ** 1,2-dibutyrin |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N |
+ | * molecular weight: | ||
+ | ** 232.276 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** glycerol 1,2-dibutanoate | ||
+ | ** β-dibutyrin | ||
+ | ** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester | ||
+ | ** dibutyrylglycerol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12086]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 24814-35-5 |
− | ** [http:// | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519] |
− | {{#set: common name= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537] | |
− | {{#set: | + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}} |
− | + | {{#set: common name=1,2-dibutyrin}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}} |
− | {{#set: | + | {{#set: molecular weight=232.276 }} |
− | {{#set: | + | {{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}} |
+ | {{#set: produced by=RXN-12086}} |
Latest revision as of 21:03, 21 March 2018
Contents
Metabolite CPD-13040
- smiles:
- CCCC(OCC(OC(CCC)=O)CO)=O
- common name:
- 1,2-dibutyrin
- inchi key:
- InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N
- molecular weight:
- 232.276
- Synonym(s):
- glycerol 1,2-dibutanoate
- β-dibutyrin
- butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
- dibutyrylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links