Difference between revisions of "Tiso gene 6838"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] == * smiles: ** CCCCCC(O)CCCCCC([O-])=O * inchi key: ** InChIKey=BNWKMHUFF...")
(Created page with "Category:Gene == Gene Tiso_gene_6838 == * right end position: ** 1730 * transcription direction: ** NEGATIVE * left end position: ** 769 * centisome position: ** 6.526352...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17637 CPD-17637] ==
+
== Gene Tiso_gene_6838 ==
−
* smiles:
+
* right end position:
−
** CCCCCC(O)CCCCCC([O-])=O
+
** 1730
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 7-hydroxylaurate
+
** 769
−
* molecular weight:
+
* centisome position:
−
** 215.312    
+
** 6.526352    
 
* Synonym(s):
 
* Synonym(s):
−
** 7-hydroxydodecanoic acid
 
−
** 7-hydroxylauric acid
 
−
** 7-hydroxydodecanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12184]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1730}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659904 90659904]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=769}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84921 84921]
+
{{#set: centisome position=6.526352   }}
−
{{#set: smiles=CCCCCC(O)CCCCCC([O-])=O}}
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: inchi key=InChIKey=BNWKMHUFFKDAMV-UHFFFAOYSA-M}}
+
−
{{#set: common name=7-hydroxylaurate}}
+
−
{{#set: molecular weight=215.312   }}
+
−
{{#set: common name=7-hydroxydodecanoic acid|7-hydroxylauric acid|7-hydroxydodecanoate}}
+
−
{{#set: consumed by=RXN-12184}}
+

Latest revision as of 21:03, 21 March 2018

Gene Tiso_gene_6838

  • right end position:
    • 1730
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 769
  • centisome position:
    • 6.526352
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6838&oldid=45518"