Difference between revisions of "Tiso gene 19791"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
(Created page with "Category:Gene == Gene Tiso_gene_19791 == * right end position: ** 1844 * transcription direction: ** POSITIVE * left end position: ** 109 * centisome position: ** 5.372104...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
+
== Gene Tiso_gene_19791 ==
−
* smiles:
+
* right end position:
−
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
+
** 1844
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** 109
−
* molecular weight:
+
* centisome position:
−
** 221.167    
+
** 5.3721046    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 
−
** 4-methyl-5-(2-phosphoethyl)-thiazole
 
−
** THZ-P
 
−
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 
−
** HET-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[THI-P-SYN-RXN]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[THIAZOLSYN3-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1844}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=109}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
+
{{#set: centisome position=5.3721046   }}
−
* BIGG : 4mpetz
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
+
−
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
+
−
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
+
−
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
−
{{#set: molecular weight=221.167   }}
+
−
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
+
−
{{#set: consumed by=THI-P-SYN-RXN}}
+
−
{{#set: produced by=THIAZOLSYN3-RXN}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_19791

  • right end position:
    • 1844
  • transcription direction:
    • POSITIVE
  • left end position:
    • 109
  • centisome position:
    • 5.3721046
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19791&oldid=45521"