Difference between revisions of "CPD0-181"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OHMETHYLBILANESYN-RXN OHMETHYLBILANESYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** hyd...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] == * smiles: ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-181 CPD0-181] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2) |
* common name: | * common name: | ||
− | ** | + | ** N5-carboxyaminoimidazole ribonucleotide |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K |
− | ** | + | * molecular weight: |
+ | ** 336.174 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole | ||
+ | ** 5-phosphoribosyl-5-carboxyaminoimidazole | ||
+ | ** N5-CAIR | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-742]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15667 C15667] | |
− | * LIGAND- | + | * HMDB : HMDB12268 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEBI: |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58730 58730] |
− | * | + | * BIGG : 5caiz |
− | ** [http://www. | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202011 25202011] | |
− | + | {{#set: smiles=C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)}} | |
− | * | + | {{#set: common name=N5-carboxyaminoimidazole ribonucleotide}} |
− | * | + | {{#set: inchi key=InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K}} |
− | ** [http:// | + | {{#set: molecular weight=336.174 }} |
− | + | {{#set: common name=5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole|5-phosphoribosyl-5-carboxyaminoimidazole|N5-CAIR}} | |
− | + | {{#set: produced by=RXN0-742}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD0-181
- smiles:
- C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)
- common name:
- N5-carboxyaminoimidazole ribonucleotide
- inchi key:
- InChIKey=JHLXDWGVSYMXPL-XVFCMESISA-K
- molecular weight:
- 336.174
- Synonym(s):
- 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole
- 5-phosphoribosyl-5-carboxyaminoimidazole
- N5-CAIR
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])([O-])=O)C2(C(O)C(O)C(N1(C=NC=C(NC(=O)[O-])1))O2)" cannot be used as a page name in this wiki.