Difference between revisions of "Tiso gene 8525"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_8525 == * right end position: ** 8687 * transcription direction: ** POSITIVE * left end position: ** 6380 * centisome position: ** 62.71503...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] ==
+
== Gene Tiso_gene_8525 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 8687
−
* common name:
+
* transcription direction:
−
** (2E,5Z)-dodecenoyl-CoA
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
+
** 6380
−
* molecular weight:
+
* centisome position:
−
** 941.776    
+
** 62.71503    
 
* Synonym(s):
 
* Synonym(s):
−
** 12:2-Δ2,Δ5-CoA
 
−
** 2-trans,5-cis-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17797]]
+
* Reaction: [[RXN-15122]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-17796]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[THREDEHYD-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY66-428]]
 +
* [[ILEUSYN-PWY]]
 +
* [[PWY-5826]]
 +
* [[PWY-5437]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=8687}}
−
{{#set: common name=(2E,5Z)-dodecenoyl-CoA}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J}}
+
{{#set: left end position=6380}}
−
{{#set: molecular weight=941.776   }}
+
{{#set: centisome position=62.71503   }}
−
{{#set: common name=12:2-Δ2,Δ5-CoA|2-trans,5-cis-dodecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15122|THREDEHYD-RXN}}
−
{{#set: consumed by=RXN-17797}}
+
{{#set: pathway associated=PWY66-428|ILEUSYN-PWY|PWY-5826|PWY-5437}}
−
{{#set: produced by=RXN-17796}}
+

Latest revision as of 21:03, 21 March 2018

Gene Tiso_gene_8525

  • right end position:
    • 8687
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6380
  • centisome position:
    • 62.71503
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8525&oldid=45525"