Difference between revisions of "Tiso gene 2224"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...") |
(Created page with "Category:Gene == Gene Tiso_gene_2224 == * right end position: ** 3659 * transcription direction: ** NEGATIVE * left end position: ** 1789 * centisome position: ** 8.914246...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2224 == |
− | * | + | * right end position: |
− | ** | + | ** 3659 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 1789 |
− | * | + | * centisome position: |
− | ** | + | ** 8.914246 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[HICH]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-13721]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-6384]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7574]] | ||
+ | * [[VALDEG-PWY]] | ||
+ | * [[PWY-3941]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3659}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=1789}} | |
− | + | {{#set: centisome position=8.914246 }} | |
− | + | {{#set: reaction associated=3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN|HICH|RXN-13721|RXN-6384}} | |
− | + | {{#set: pathway associated=PWY-7574|VALDEG-PWY|PWY-3941}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:03, 21 March 2018
Gene Tiso_gene_2224
- right end position:
- 3659
- transcription direction:
- NEGATIVE
- left end position:
- 1789
- centisome position:
- 8.914246
- Synonym(s):
Reactions associated
- Reaction: 3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: HICH
- Source: orthology-creinhardtii
- Reaction: RXN-13721
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-6384
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation