Difference between revisions of "Tiso gene 11797"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_11797 == * right end position: ** 2696 * transcription direction: ** POSITIVE * left end position: ** 758 * centisome position: ** 10.08246...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11797 == |
− | * | + | * right end position: |
− | ** | + | ** 2696 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 758 |
− | * | + | * centisome position: |
− | ** | + | ** 10.082468 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.1.22.4-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2696}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=758}} | |
− | + | {{#set: centisome position=10.082468 }} | |
− | + | {{#set: reaction associated=3.1.22.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:03, 21 March 2018
Gene Tiso_gene_11797
- right end position:
- 2696
- transcription direction:
- POSITIVE
- left end position:
- 758
- centisome position:
- 10.082468
- Synonym(s):
Reactions associated
- Reaction: 3.1.22.4-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation