Difference between revisions of "CPD-6993"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15377 CPD-15377] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * common name:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == |
* smiles: | * smiles: | ||
− | ** | + | ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pinocembrin chalcone |
+ | * inchi key: | ||
+ | ** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 256.257 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7647]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] |
− | * | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] |
− | {{#set: smiles= | + | {{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} |
− | {{#set: | + | {{#set: common name=pinocembrin chalcone}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=256.257 }} |
− | {{#set: | + | {{#set: consumed by=RXN-7647}} |
− | + |
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD-6993
- smiles:
- C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
- common name:
- pinocembrin chalcone
- inchi key:
- InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
- molecular weight:
- 256.257
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links