|
|
(3 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTP-PYROP-RXN DUTP-PYROP-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) |
| * common name: | | * common name: |
− | ** inosine_triphosphate | + | ** pinocembrin chalcone |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.6.1.23 EC-3.6.1.23] | + | ** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N |
− | ** [http://enzyme.expasy.org/EC/3.6.1.9 EC-3.6.1.9] | + | * molecular weight: |
| + | ** 256.257 |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-7647]] |
− | ** 1 [[WATER]][c] '''+''' 1 [[DUTP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[DUMP]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 dUTP[c] '''=>''' 1 diphosphate[c] '''+''' 1 dUMP[c] '''+''' 1 H+[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_18793]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_18792]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-7206]], pyrimidine deoxyribonucleotides dephosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7206 PWY-7206]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-7184]], pyrimidine deoxyribonucleotides de novo biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7184 PWY-7184]
| + | |
− | ** '''9''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187]
| + | |
− | ** '''4''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-6545]], pyrimidine deoxyribonucleotides de novo biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6545 PWY-6545]
| + | |
− | ** '''8''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
| + | |
− | ** '''12''' reactions found over '''17''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[athaliana]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10248 10248] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295] |
− | * LIGAND-RXN: | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R02100 R02100] | + | ** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/Q89932 Q89932]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] |
− | ** [http://www.uniprot.org/uniprot/P33316 P33316] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/O15923 O15923] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] |
− | ** [http://www.uniprot.org/uniprot/Q9PMK9 Q9PMK9]
| + | {{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} |
− | ** [http://www.uniprot.org/uniprot/Q9Z9C2 Q9Z9C2]
| + | {{#set: common name=pinocembrin chalcone}} |
− | ** [http://www.uniprot.org/uniprot/Q9JUW1 Q9JUW1] | + | {{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} |
− | ** [http://www.uniprot.org/uniprot/P43792 P43792] | + | {{#set: molecular weight=256.257 }} |
− | ** [http://www.uniprot.org/uniprot/P32518 P32518]
| + | {{#set: consumed by=RXN-7647}} |
− | ** [http://www.uniprot.org/uniprot/P68635 P68635]
| + | |
− | ** [http://www.uniprot.org/uniprot/P68634 P68634]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q76RE7 Q76RE7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P03195 P03195]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q89662 Q89662]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00030 Q00030]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33317 P33317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q45920 Q45920]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43058 P43058]
| + | |
− | ** [http://www.uniprot.org/uniprot/O80091 O80091]
| + | |
− | ** [http://www.uniprot.org/uniprot/O36404 O36404]
| + | |
− | ** [http://www.uniprot.org/uniprot/O41033 O41033]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9YML1 Q9YML1]
| + | |
− | ** [http://www.uniprot.org/uniprot/O39251 O39251]
| + | |
− | ** [http://www.uniprot.org/uniprot/O01934 O01934]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10234 P10234]
| + | |
− | ** [http://www.uniprot.org/uniprot/P06968 P06968]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09254 P09254]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28892 P28892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28893 P28893]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=inosine_triphosphate}}
| + | |
− | {{#set: ec number=EC-3.6.1.23}}
| + | |
− | {{#set: ec number=EC-3.6.1.9}}
| + | |
− | {{#set: gene associated=Tiso_gene_18793|Tiso_gene_18792}}
| + | |
− | {{#set: in pathway=PWY-7206|PWY-7184|PWY-7187|PWY-6545|PWY0-166}}
| + | |
− | {{#set: reconstruction category=orthology}}
| + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=athaliana}}
| + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=in-silico_annotation}} | + | |