Difference between revisions of "CPD-356"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11480 RXN-11480] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-carrier-pro...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == * smiles: ** C(O)C1(OC(=O)C(O)C(O)1) * common name: ** D-arabinono-1,4-lact...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-356 CPD-356] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(=O)C(O)C(O)1) |
* common name: | * common name: | ||
− | ** | + | ** D-arabinono-1,4-lactone |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N |
+ | * molecular weight: | ||
+ | ** 148.115 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.1.3.37-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=17723 17723] | |
− | + | * CHEMSPIDER: | |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.16751.html 16751] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16292 16292] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00652 C00652] |
+ | {{#set: smiles=C(O)C1(OC(=O)C(O)C(O)1)}} | ||
+ | {{#set: common name=D-arabinono-1,4-lactone}} | ||
+ | {{#set: inchi key=InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N}} | ||
+ | {{#set: molecular weight=148.115 }} | ||
+ | {{#set: consumed by=1.1.3.37-RXN}} |
Latest revision as of 21:03, 21 March 2018
Contents
Metabolite CPD-356
- smiles:
- C(O)C1(OC(=O)C(O)C(O)1)
- common name:
- D-arabinono-1,4-lactone
- inchi key:
- InChIKey=CUOKHACJLGPRHD-JJYYJPOSSA-N
- molecular weight:
- 148.115
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links