Difference between revisions of "KYNURENINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KYNURENINASE-RXN KYNURENINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** kynureninase...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KYNURENINASE-RXN KYNURENINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** kynureninase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.7.1.3 EC-3.7.1.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-14736]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''+''' 1 [[ANTHRANILATE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 L-kynurenine[c] '''=>''' 1 H+[c] '''+''' 1 L-alanine[c] '''+''' 1 anthranilate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10685]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10684]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[TRPCAT-PWY]], L-tryptophan degradation I (via anthranilate): [http://metacyc.org/META/NEW-IMAGE?object=TRPCAT-PWY TRPCAT-PWY] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] | ||
+ | ** '''9''' reactions found over '''17''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * RHEA: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16813 16813] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00987 R00987] |
− | + | * UNIPROT: | |
− | + | ** [http://www.uniprot.org/uniprot/Q16719 Q16719] | |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P70712 P70712] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | {{#set: | + | {{#set: common name=kynureninase}} |
− | {{#set: | + | {{#set: ec number=EC-3.7.1.3}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_10685|Tiso_gene_10684}} |
− | {{#set: | + | {{#set: in pathway=TRPCAT-PWY|PWY-6309}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:03, 21 March 2018
Contents
Reaction KYNURENINASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- kynureninase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-14736[c] => 1 PROTON[c] + 1 L-ALPHA-ALANINE[c] + 1 ANTHRANILATE[c]
- With common name(s):
- 1 H2O[c] + 1 L-kynurenine[c] => 1 H+[c] + 1 L-alanine[c] + 1 anthranilate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10685
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10684
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- TRPCAT-PWY, L-tryptophan degradation I (via anthranilate): TRPCAT-PWY
- 2 reactions found over 3 reactions in the full pathway
- PWY-6309, L-tryptophan degradation XI (mammalian, via kynurenine): PWY-6309
- 9 reactions found over 17 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links