Difference between revisions of "Tiso gene 14646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * inchi key: ** InChIKey=NPYQJIHH...")
(Created page with "Category:Gene == Gene Tiso_gene_14646 == * right end position: ** 2190 * transcription direction: ** NEGATIVE * left end position: ** 1109 * centisome position: ** 20.1015...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] ==
+
== Gene Tiso_gene_14646 ==
−
* smiles:
+
* right end position:
−
** CC(C(=O)[O-])C(O)C([O-])=O
+
** 2190
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** (2R,3S)-3-methylmalate
+
** 1109
−
* molecular weight:
+
* centisome position:
−
** 146.099    
+
** 20.101503    
 
* Synonym(s):
 
* Synonym(s):
−
** D-erythro-3-methylmalate
 
−
** erythro-β-methyl-D-malate
 
−
** β-erythro-methylmalate
 
−
** β-methyl-D-malate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7745]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2190}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=1109}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511]
+
{{#set: centisome position=20.101503   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}}
+
−
{{#set: common name=(2R,3S)-3-methylmalate}}
+
−
{{#set: molecular weight=146.099   }}
+
−
{{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}}
+
−
{{#set: consumed by=RXN-7745}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_14646

  • right end position:
    • 2190
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1109
  • centisome position:
    • 20.101503
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14646&oldid=45578"