Difference between revisions of "Tiso gene 15721"

Latest revision as of 21:03, 21 March 2018

Reaction: 2.7.1.68-RXN
- Source: annotation-in-silico_annotation
  - Assignment: automated-name-match

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] ==
+== Gene Tiso_gene_15721 ==
-* smiles:
+* right end position:
-** C([R])C(=O)CC(=O)[O-]
+** 4790
-* common name:
+* transcription direction:
-** a 3-oxo acid
+** NEGATIVE
+* left end position:
+** 1031
+* centisome position:
+** 21.27089
 * Synonym(s):
-** 3-oxy acid
-** 3-oxygen acid
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-== Reaction(s) known to produce the compound ==
+* Reaction: [[2.7.1.68-RXN]]
-== Reaction(s) of unknown directionality ==
+** Source: [[annotation-in-silico_annotation]]
-* [[3-OXOACID-COA-TRANSFERASE-RXN]]
+*** Assignment: automated-name-match
+== Pathways associated ==
+* [[PWY-6352]]
+* [[PWY-6351]]
 == External links  ==
-* LIGAND-CPD:
+{{#set: right end position=4790}}
-** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656]
+{{#set: transcription direction=NEGATIVE}}
-* CHEBI:
+{{#set: left end position=1031}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881]
+{{#set: centisome position=21.27089    }}
-{{#set: smiles=C([R])C(=O)CC(=O)[O-]}}
+{{#set: reaction associated=2.7.1.68-RXN}}
-{{#set: common name=a 3-oxo acid}}
+{{#set: pathway associated=PWY-6352|PWY-6351}}
-{{#set: common name=3-oxy acid|3-oxygen acid}}
-{{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}}