Difference between revisions of "Tiso gene 15721"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == * smiles: ** C([R])C(=O)CC(=O)[O-] * common name: ** a 3-oxo acid...")
(Created page with "Category:Gene == Gene Tiso_gene_15721 == * right end position: ** 4790 * transcription direction: ** NEGATIVE * left end position: ** 1031 * centisome position: ** 21.2708...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] ==
+
== Gene Tiso_gene_15721 ==
* smiles:
+
* right end position:
** C([R])C(=O)CC(=O)[O-]
+
** 4790
* common name:
+
* transcription direction:
** a 3-oxo acid
+
** NEGATIVE
 +
* left end position:
 +
** 1031
 +
* centisome position:
 +
** 21.27089   
 
* Synonym(s):
 
* Synonym(s):
** 3-oxy acid
 
** 3-oxygen acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.7.1.68-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[3-OXOACID-COA-TRANSFERASE-RXN]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: right end position=4790}}
** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: left end position=1031}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881]
+
{{#set: centisome position=21.27089    }}
{{#set: smiles=C([R])C(=O)CC(=O)[O-]}}
+
{{#set: reaction associated=2.7.1.68-RXN}}
{{#set: common name=a 3-oxo acid}}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
{{#set: common name=3-oxy acid|3-oxygen acid}}
+
{{#set: reversible reaction associated=3-OXOACID-COA-TRANSFERASE-RXN}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_15721

  • right end position:
    • 4790
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1031
  • centisome position:
    • 21.27089
  • Synonym(s):

Reactions associated

Pathways associated

External links