Difference between revisions of "2-OCTAPRENYL-6-HYDROXYPHENOL"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1773 == * left end position: ** 16660 * transcription direction: ** POSITIVE * right end position: ** 18855 * centisome position: ** 76.601...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-HYDROXYPHENOL 2-OCTAPRENYL-6-HYDROXYPHENOL] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-HYDROXYPHENOL 2-OCTAPRENYL-6-HYDROXYPHENOL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C |
− | * | + | * common name: |
− | ** | + | ** 3-(all-trans-octaprenyl)benzene-1,2-diol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 655.058 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-octaprenyl-6-hydroxyphenol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280833 5280833] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4444382.html 4444382] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1233 1233] |
+ | * BIGG : 2ohph | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05811 C05811] | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C}} | ||
+ | {{#set: common name=3-(all-trans-octaprenyl)benzene-1,2-diol}} | ||
+ | {{#set: inchi key=InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N}} | ||
+ | {{#set: molecular weight=655.058 }} | ||
+ | {{#set: common name=2-octaprenyl-6-hydroxyphenol}} | ||
+ | {{#set: consumed by=2-OCTAPRENYL-6-OHPHENOL-METHY-RXN}} |
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C
- common name:
- 3-(all-trans-octaprenyl)benzene-1,2-diol
- inchi key:
- InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N
- molecular weight:
- 655.058
- Synonym(s):
- 2-octaprenyl-6-hydroxyphenol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links