Difference between revisions of "ILE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7979 == * right end position: ** 3675 * transcription direction: ** NEGATIVE * left end position: ** 232 * centisome position: ** 2.1786082...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * common name: ** L-isoleucine * inchi key: **...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(C)C([N+])C(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** L-isoleucine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 131.174 |
* Synonym(s): | * Synonym(s): | ||
| + | ** I | ||
| + | ** ile | ||
| + | ** iso-leucine | ||
| + | ** L-ile | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[ISOLEUCINE--TRNA-LIGASE-RXN]] |
| − | * | + | * [[RME144]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | * [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 73-32-5 |
| − | {{#set: | + | * BIGG : ile__L |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7043901 7043901] |
| − | {{#set: | + | * HMDB : HMDB00172 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00407 C00407] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58045 58045] | ||
| + | * METABOLIGHTS : MTBLC58045 | ||
| + | {{#set: smiles=CCC(C)C([N+])C(=O)[O-]}} | ||
| + | {{#set: common name=L-isoleucine}} | ||
| + | {{#set: inchi key=InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N}} | ||
| + | {{#set: molecular weight=131.174 }} | ||
| + | {{#set: common name=I|ile|iso-leucine|L-ile}} | ||
| + | {{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN|RME144}} | ||
| + | {{#set: reversible reaction associated=BRANCHED-CHAINAMINOTRANSFERILEU-RXN}} | ||
Latest revision as of 21:04, 21 March 2018
Contents
Metabolite ILE
- smiles:
- CCC(C)C([N+])C(=O)[O-]
- common name:
- L-isoleucine
- inchi key:
- InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N
- molecular weight:
- 131.174
- Synonym(s):
- I
- ile
- iso-leucine
- L-ile
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-32-5
- BIGG : ile__L
- PUBCHEM:
- HMDB : HMDB00172
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58045
"CCC(C)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
