Difference between revisions of "CPD-67"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] == * common name: ** an oxidized flavodoxin * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * common name: ** 2-phosphoglycolat...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == |
| + | * smiles: | ||
| + | ** C(OP([O-])(=O)[O-])C([O-])=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-phosphoglycolate |
| + | * inchi key: | ||
| + | ** InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K | ||
| + | * molecular weight: | ||
| + | ** 153.008 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-P-glycolate |
| + | ** phosphoglycolate | ||
| + | ** Phosphoglycolic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GPH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 2pglyc |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916760 24916760] |
| − | {{#set: | + | * HMDB : HMDB00816 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00988 C00988] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58033 58033] | ||
| + | * METABOLIGHTS : MTBLC58033 | ||
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C([O-])=O}} | ||
| + | {{#set: common name=2-phosphoglycolate}} | ||
| + | {{#set: inchi key=InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K}} | ||
| + | {{#set: molecular weight=153.008 }} | ||
| + | {{#set: common name=2-P-glycolate|phosphoglycolate|Phosphoglycolic acid}} | ||
| + | {{#set: consumed by=GPH-RXN}} | ||
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-67
- smiles:
- C(OP([O-])(=O)[O-])C([O-])=O
- common name:
- 2-phosphoglycolate
- inchi key:
- InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K
- molecular weight:
- 153.008
- Synonym(s):
- 2-P-glycolate
- phosphoglycolate
- Phosphoglycolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 2pglyc
- PUBCHEM:
- HMDB : HMDB00816
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58033
"C(OP([O-])(=O)[O-])C([O-])=O" cannot be used as a page name in this wiki.
