Difference between revisions of "Tiso gene 18092"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Gene == Gene Tiso_gene_18092 == * right end position: ** 1860 * transcription direction: ** POSITIVE * left end position: ** 50 * centisome position: ** 1.5356265...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18092 == |
− | * | + | * right end position: |
− | ** | + | ** 1860 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 50 |
− | * | + | * centisome position: |
− | ** | + | ** 1.5356265 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PGPPHOSPHA-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13313]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY4FS-7]] | ||
+ | * [[PWY4FS-8]] | ||
+ | * [[PWY-5269]] | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWY-5668]] | ||
+ | * [[PWY0-1545]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1860}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=50}} | |
− | + | {{#set: centisome position=1.5356265 }} | |
− | + | {{#set: reaction associated=PGPPHOSPHA-RXN|RXN-13313}} | |
− | + | {{#set: pathway associated=PWY4FS-7|PWY4FS-8|PWY-5269|PWY-7817|PWY-5668|PWY0-1545}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:04, 21 March 2018
Gene Tiso_gene_18092
- right end position:
- 1860
- transcription direction:
- POSITIVE
- left end position:
- 50
- centisome position:
- 1.5356265
- Synonym(s):
Reactions associated
- Reaction: PGPPHOSPHA-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13313
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation