Difference between revisions of "Tiso gene 917"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-334 CPD-334] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)=O)O)O)O * common name: ** 2,3-dioxo-L-...") |
(Created page with "Category:Gene == Gene Tiso_gene_917 == * Synonym(s): == Reactions associated == * Reaction: 1.3.99.23-RXN ** Source: annotation-in-silico_annotation *** Assignmen...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_917 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[1.3.99.23-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[RXN- | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[R95]] |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Reaction: [[R96]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Reaction: [[RXN-8042]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6475]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.3.99.23-RXN|R95|R96|RXN-8042}} | |
− | + | {{#set: pathway associated=PWY-6475}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:04, 21 March 2018
Gene Tiso_gene_917
- Synonym(s):
Reactions associated
- Reaction: 1.3.99.23-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: R95
- Source: orthology-synechocystis
- Reaction: R96
- Source: orthology-synechocystis
- Reaction: RXN-8042
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation