Difference between revisions of "Short-RNA-Fragments"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-RNA-Fragments Short-RNA-Fragments] == * common name: ** a short RNA Segment * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-RNA-Fragments Short-RNA-Fragments] ==
* smiles:
+
** CC(=O)C1(C=CC=CC=1)
+
* inchi key:
+
** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** acetophenone
+
** a short RNA Segment
* molecular weight:
+
** 120.151   
+
 
* Synonym(s):
 
* Synonym(s):
** phenylmethylketone
 
** methylphenylketone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-1302]]
+
* [[RXN0-5021]]
 
== External links  ==
 
== External links  ==
* CAS : 98-86-2
+
{{#set: common name=a short RNA Segment}}
* DRUGBANK : DB04619
+
{{#set: reversible reaction associated=RXN0-5021}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410]
+
* HMDB : HMDB33910
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7132.html 7132]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632]
+
{{#set: smiles=CC(=O)C1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}}
+
{{#set: common name=acetophenone}}
+
{{#set: molecular weight=120.151    }}
+
{{#set: common name=phenylmethylketone|methylphenylketone}}
+
{{#set: reversible reaction associated=RXN-1302}}
+

Latest revision as of 20:04, 21 March 2018

Metabolite Short-RNA-Fragments

  • common name:
    • a short RNA Segment
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links