|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CARBODEHYDRAT-RXN CARBODEHYDRAT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(=O)C1(C=CC=CC=1) |
| * common name: | | * common name: |
− | ** carbonic_anhydrase | + | ** acetophenone |
− | ** ORF | + | * inchi key: |
− | ** beta-type_carbonic_anhydrase | + | ** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N |
− | ** gamma_carbonic_anhydrase | + | * molecular weight: |
− | ** alpha_ca
| + | ** 120.151 |
− | * ec number:
| + | |
− | ** [http://enzyme.expasy.org/EC/4.2.1.1 EC-4.2.1.1] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** phenylmethylketone |
| + | ** methylphenylketone |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[H2CO3]][c] '''<=>''' 1 [[WATER]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
| + | == Reaction(s) of unknown directionality == |
− | * With common name(s):
| + | * [[RXN-1302]] |
− | ** 1 carbonic acid[c] '''<=>''' 1 H2O[c] '''+''' 1 CO2[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * Gene: [[Tiso_gene_1600]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Gene: [[Tiso_gene_17511]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_9852]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_3056]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_20230]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_19414]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Gene: [[Tiso_gene_7660]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | * Gene: [[Tiso_gene_19413]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | * Gene: [[Tiso_gene_18927]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | * Gene: [[Tiso_gene_6150]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Assignment: EC-NUMBER
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]] | + | |
− | ** Source: [[orthology-creinhardtii]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 98-86-2 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10748 10748]
| + | * DRUGBANK : DB04619 |
− | * LIGAND-RXN:
| + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00132 R00132]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410] |
− | * UNIPROT: | + | * HMDB : HMDB33910 |
− | ** [http://www.uniprot.org/uniprot/P07450 P07450] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P07452 P07452] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113] |
− | ** [http://www.uniprot.org/uniprot/P13634 P13634]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P08060 P08060]
| + | ** [http://www.chemspider.com/Chemical-Structure.7132.html 7132] |
− | ** [http://www.uniprot.org/uniprot/P16016 P16016] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P20507 P20507] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632] |
− | ** [http://www.uniprot.org/uniprot/P16015 P16015] | + | {{#set: smiles=CC(=O)C1(C=CC=CC=1)}} |
− | ** [http://www.uniprot.org/uniprot/P40881 P40881] | + | {{#set: common name=acetophenone}} |
− | ** [http://www.uniprot.org/uniprot/Q7LZP1 Q7LZP1] | + | {{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/Q8X938 Q8X938]
| + | {{#set: molecular weight=120.151 }} |
− | ** [http://www.uniprot.org/uniprot/P00921 P00921] | + | {{#set: common name=phenylmethylketone|methylphenylketone}} |
− | ** [http://www.uniprot.org/uniprot/P00917 P00917] | + | {{#set: reversible reaction associated=RXN-1302}} |
− | ** [http://www.uniprot.org/uniprot/P00915 P00915]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00918 P00918]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07451 P07451]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22748 P22748]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35218 P35218]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43166 P43166]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00916 P00916]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00920 P00920]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00922 P00922]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24855 O24855]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PIQ7 Q9PIQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14141 P14141]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43165 P43165]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07630 P07630]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27139 P27139]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35219 P35219]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M317 Q7M317]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M316 Q7M316]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ABE9 P0ABE9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18761 P18761]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17067 P17067]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23589 P23589]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24258 P24258]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27140 P27140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27134 P27134]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46510 P46510]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46511 P46511]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46512 P46512]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46281 P46281]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18915 P18915]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41728 Q41728]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41729 Q41729]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27141 P27141]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40628 Q40628]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08056 Q08056]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40880 P40880]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q39588 Q39588]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93108 P93108]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q92051 Q92051]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04855 O04855]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41088 Q41088]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41089 Q41089]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46513 P46513]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04846 O04846]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=carbonic_anhydrase}}
| + | |
− | {{#set: common name=ORF}}
| + | |
− | {{#set: common name=beta-type_carbonic_anhydrase}}
| + | |
− | {{#set: common name=gamma_carbonic_anhydrase}}
| + | |
− | {{#set: common name=alpha_ca}} | + | |
− | {{#set: ec number=EC-4.2.1.1}} | + | |
− | {{#set: gene associated=Tiso_gene_1600|Tiso_gene_17511|Tiso_gene_9852|Tiso_gene_3056|Tiso_gene_20230|Tiso_gene_19414|Tiso_gene_7660|Tiso_gene_19413|Tiso_gene_18927|Tiso_gene_6150}} | + | |
− | {{#set: in pathway=}} | + | |
− | {{#set: reconstruction category=orthology|annotation}}
| + | |
− | {{#set: reconstruction source=orthology-creinhardtii|annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}}
| + | |