Difference between revisions of "RXN-14809"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14809 RXN-14809] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14809 RXN-14809] ==
* smiles:
+
* direction:
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
* common name:
+
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
* molecular weight:
+
** 211.045   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
 
** 2-oxo-3-hydroxy-4-phosphobutanoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[L-arabinofuranose]][c] '''<=>''' 1 [[L-arabinopyranose]][c]
* [[PSERTRANSAMPYR-RXN]]
+
* With common name(s):
 +
**
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5517]], L-arabinose degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5517 PWY-5517]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-7295]], L-arabinose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
{{#set: in pathway=PWY-5517|PWY-7295}}
* CHEBI:
+
{{#set: reconstruction category=annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* BIGG : ohpb
+
{{#set: reconstruction tool=pathwaytools}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
* HMDB : HMDB06801
+
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
{{#set: molecular weight=211.045    }}
+
{{#set: common name=3-hydroxy-4-phospho-hydroxy-&alpha;-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
{{#set: reversible reaction associated=PSERTRANSAMPYR-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Reaction RXN-14809

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5517, L-arabinose degradation III: PWY-5517
    • 1 reactions found over 6 reactions in the full pathway
  • PWY-7295, L-arabinose degradation IV: PWY-7295
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links