Difference between revisions of "Tiso gene 2991"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CH33ADO CH33ADO] == * smiles: ** CC1(OC(C(O)C(O)1)N3(C=NC2(C(N)=NC=NC=23))) * inchi key: ** InC...") |
(Created page with "Category:Gene == Gene Tiso_gene_2991 == * right end position: ** 1629 * transcription direction: ** POSITIVE * left end position: ** 723 * centisome position: ** 4.070717...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2991 == |
− | * | + | * right end position: |
− | ** | + | ** 1629 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 723 |
− | * | + | * centisome position: |
− | ** | + | ** 4.070717 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | == Pathways associated == | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=1629}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=723}} | |
− | + | {{#set: centisome position=4.070717 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:04, 21 March 2018
Gene Tiso_gene_2991
- right end position:
- 1629
- transcription direction:
- POSITIVE
- left end position:
- 723
- centisome position:
- 4.070717
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-RNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation