Difference between revisions of "RXN1G-363"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-363 RXN1G-363] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-363 RXN1G-363] ==
−
* smiles:
+
* direction:
−
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
−
* common name:
+
−
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
−
* molecular weight:
+
−
** 211.045   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
 
−
** 2-oxo-3-hydroxy-4-phosphobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[R-3-hydroxybehenoyl-ACPs]][c] '''=>''' 1 [[trans-delta2-behenoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
−
* [[PSERTRANSAMPYR-RXN]]
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxybehenoyl-[acp][c] '''=>''' 1 a trans-docos-2-enoyl-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6884]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
{{#set: ec number=EC-4.2.1.59}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6884}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
{{#set: in pathway=PWYG-321}}
−
* BIGG : ohpb
+
{{#set: reconstruction category=annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
{{#set: reconstruction tool=pathwaytools}}
−
* HMDB : HMDB06801
+
−
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
−
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
−
{{#set: molecular weight=211.045    }}
+
−
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
−
{{#set: consumed or produced by=PSERTRANSAMPYR-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Reaction RXN1G-363

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-363&oldid=45695"